C16H15N3O7S2 — CID 88783782
(6R,7R)-3-(acetyloxymethyl)-7-[[(2Z)-2-hydroxyimino-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88783782) has the molecular formula C16H15N3O7S2 and a molecular weight of 425.44 g/mol. Its IUPAC name is (6R,7R)-3-(acetyloxymethyl)-7-[[(2Z)-2-hydroxyimino-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(acetyloxymethyl)-7-[[(2Z)-2-hydroxyimino-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88783782 |
| Molecular Formula | C16H15N3O7S2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-[[(2Z)-2-hydroxyimino-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N/O)c3cccs3)[C@H]2SC1 |
| InChI | InChI=1S/C16H15N3O7S2/c1-7(20)26-5-8-6-28-15-11(14(22)19(15)12(8)16(23)24)17-13(21)10(18-25)9-3-2-4-27-9/h2-4,11,15,25H,5-6H2,1H3,(H,17,21)(H,23,24)/b18-10+/t11-,15-/m1/s1 |
| InChIKey | BBPNSFYQNZXRDI-RRJNMYPRSA-N |
| XLogP | 0.23 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|