C16H17N5O7S2 — CID 88775227
(6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88775227) has the molecular formula C16H17N5O7S2 and a molecular weight of 455.47 g/mol. Its IUPAC name is (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88775227 |
| Molecular Formula | C16H17N5O7S2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(=NO)c3nc(N)sc3C)[C@H]2SC1 |
| InChI | InChI=1S/C16H17N5O7S2/c1-5-8(19-16(17)30-5)9(20-27)12(23)18-10-13(24)21-11(15(25)26)7(3-28-6(2)22)4-29-14(10)21/h10,14,27H,3-4H2,1-2H3,(H2,17,19)(H,18,23)(H,25,26)/t10-,14-/m1/s1 |
| InChIKey | CMVPIUSOEOONPR-QMTHXVAHSA-N |
| XLogP | -0.49 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|