C21H26N2O8S — CID 70448029
methyl 3-methyl-2-[(2R,3R)-2-methylsulfanyl-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-1-yl]but-2-enoate (PubChem CID 70448029) has the molecular formula C21H26N2O8S and a molecular weight of 466.51 g/mol. Its IUPAC name is methyl 3-methyl-2-[(2R,3R)-2-methylsulfanyl-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-1-yl]but-2-enoate.
| Compound Name | methyl 3-methyl-2-[(2R,3R)-2-methylsulfanyl-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 70448029 |
| Molecular Formula | C21H26N2O8S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | methyl 3-methyl-2-[(2R,3R)-2-methylsulfanyl-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-1-yl]but-2-enoate |
| SMILES | COC(=O)C(=C(C)C)N1C(=O)[C@@H](C(C)(C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)[C@H]1SC |
| InChI | InChI=1S/C21H26N2O8S/c1-12(2)16(19(25)29-5)22-17(24)15(18(22)32-6)21(3,4)31-20(26)30-11-13-7-9-14(10-8-13)23(27)28/h7-10,15,18H,11H2,1-6H3/t15-,18-/m1/s1 |
| InChIKey | OBJICLRVVABCCH-CRAIPNDOSA-N |
| XLogP | 3.64 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|