C18H22N2O6S — CID 70611304
(4-nitrophenyl)methyl (E)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate (PubChem CID 70611304) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate |
|---|---|
| PubChem CID | 70611304 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-2-(2-ethylsulfanyl-4-oxoazetidin-1-yl)-3-methoxypent-2-enoate |
| SMILES | CCSC1CC(=O)N1/C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(\CC)OC |
| InChI | InChI=1S/C18H22N2O6S/c1-4-14(25-3)17(19-15(21)10-16(19)27-5-2)18(22)26-11-12-6-8-13(9-7-12)20(23)24/h6-9,16H,4-5,10-11H2,1-3H3/b17-14+ |
| InChIKey | JOSXVQCNPIVQBR-SAPNQHFASA-N |
| XLogP | 3.22 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|