C22H30N2O7SSi — CID 70408537
(5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(hydroxymethyl)-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 70408537) has the molecular formula C22H30N2O7SSi and a molecular weight of 494.64 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(hydroxymethyl)-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(hydroxymethyl)-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70408537 |
| Molecular Formula | C22H30N2O7SSi |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(hydroxymethyl)-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C(CO)S[C@]12Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H30N2O7SSi/c1-13(31-33(5,6)21(2,3)4)17-19(26)23-18(20(27)28)16(12-25)32-22(17,23)11-14-7-9-15(10-8-14)24(29)30/h7-10,13,17,25H,11-12H2,1-6H3,(H,27,28)/t13-,17+,22-/m1/s1 |
| InChIKey | DPIBMAPTEJUZEJ-LEXZLQQCSA-N |
| XLogP | 3.74 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|