C16H27NO2Si — CID 177385780
(5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-1-azabicyclo[3.2.0]hept-2-en-7-one (PubChem CID 177385780) has the molecular formula C16H27NO2Si and a molecular weight of 293.48 g/mol. Its IUPAC name is (5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-1-azabicyclo[3.2.0]hept-2-en-7-one.
| Compound Name | (5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-1-azabicyclo[3.2.0]hept-2-en-7-one |
|---|---|
| PubChem CID | 177385780 |
| Molecular Formula | C16H27NO2Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethenyl-1-azabicyclo[3.2.0]hept-2-en-7-one |
| SMILES | C=CC1=CC[C@@H]2[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C16H27NO2Si/c1-8-12-9-10-13-14(15(18)17(12)13)11(2)19-20(6,7)16(3,4)5/h8-9,11,13-14H,1,10H2,2-7H3/t11-,13-,14+/m1/s1 |
| InChIKey | GQQNRIWPGIHXAP-BNOWGMLFSA-N |
| XLogP | 3.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|