C23H33IN2O2SeSi — CID 135053654
(5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-(4-methylphenyl)imino-3-selena-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 135053654) has the molecular formula C23H33IN2O2SeSi and a molecular weight of 603.48 g/mol. Its IUPAC name is (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-(4-methylphenyl)imino-3-selena-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-(4-methylphenyl)imino-3-selena-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 135053654 |
| Molecular Formula | C23H33IN2O2SeSi |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-(4-methylphenyl)imino-3-selena-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | C=C(I)C1(C)[Se]/C(=N\c2ccc(C)cc2)N2C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C23H33IN2O2SeSi/c1-14-10-12-17(13-11-14)25-21-26-19(23(7,29-21)16(3)24)18(20(26)27)15(2)28-30(8,9)22(4,5)6/h10-13,15,18-19H,3H2,1-2,4-9H3/b25-21-/t15-,18-,19+,23?/m1/s1 |
| InChIKey | MVSIKESTXCPIPP-ITPUSUNESA-N |
| XLogP | 6.06 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|