C22H31IN2O2SSi — CID 122397279
(5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-phenylimino-3-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 122397279) has the molecular formula C22H31IN2O2SSi and a molecular weight of 542.56 g/mol. Its IUPAC name is (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-phenylimino-3-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-phenylimino-3-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 122397279 |
| Molecular Formula | C22H31IN2O2SSi |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(1-iodoethenyl)-4-methyl-2-phenylimino-3-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | C=C(I)C1(C)S/C(=N\c2ccccc2)N2C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C22H31IN2O2SSi/c1-14(27-29(7,8)21(3,4)5)17-18-22(6,15(2)23)28-20(25(18)19(17)26)24-16-12-10-9-11-13-16/h9-14,17-18H,2H2,1,3-8H3/b24-20-/t14-,17-,18+,22?/m1/s1 |
| InChIKey | ZQQJTLKDHLOFRP-JAUNMVPFSA-N |
| XLogP | 6.37 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|