C21H29IN2O2SSi — CID 122397275
(6S,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(iodomethyl)-2-phenylimino-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one (PubChem CID 122397275) has the molecular formula C21H29IN2O2SSi and a molecular weight of 528.53 g/mol. Its IUPAC name is (6S,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(iodomethyl)-2-phenylimino-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one.
| Compound Name | (6S,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(iodomethyl)-2-phenylimino-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one |
|---|---|
| PubChem CID | 122397275 |
| Molecular Formula | C21H29IN2O2SSi |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | (6S,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(iodomethyl)-2-phenylimino-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2/C(=N/c3ccccc3)SC(CI)=C[C@H]12 |
| InChI | InChI=1S/C21H29IN2O2SSi/c1-14(26-28(5,6)21(2,3)4)18-17-12-16(13-22)27-20(24(17)19(18)25)23-15-10-8-7-9-11-15/h7-12,14,17-18H,13H2,1-6H3/b23-20-/t14-,17-,18-/m1/s1 |
| InChIKey | FJOOBUPAKWPDDX-HUWIOEQCSA-N |
| XLogP | 5.98 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|