C21H28ClIN2O2SSi — CID 132531773
(4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-chlorophenyl)imino-4-(iodomethylidene)-3-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 132531773) has the molecular formula C21H28ClIN2O2SSi and a molecular weight of 562.98 g/mol. Its IUPAC name is (4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-chlorophenyl)imino-4-(iodomethylidene)-3-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-chlorophenyl)imino-4-(iodomethylidene)-3-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 132531773 |
| Molecular Formula | C21H28ClIN2O2SSi |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | (4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-chlorophenyl)imino-4-(iodomethylidene)-3-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2/C(=N/c3ccccc3Cl)S/C(=C/I)C[C@H]12 |
| InChI | InChI=1S/C21H28ClIN2O2SSi/c1-13(27-29(5,6)21(2,3)4)18-17-11-14(12-23)28-20(25(17)19(18)26)24-16-10-8-7-9-15(16)22/h7-10,12-13,17-18H,11H2,1-6H3/b14-12+,24-20-/t13-,17-,18-/m1/s1 |
| InChIKey | NBSSJWDEBPLMHK-BCLFCHOISA-N |
| XLogP | 6.98 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|