C21H31ClN2O2SSi — CID 122387183
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(2-chlorophenyl)-2-oxo-4-prop-2-enylazetidine-1-carbothioamide (PubChem CID 122387183) has the molecular formula C21H31ClN2O2SSi and a molecular weight of 439.10 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(2-chlorophenyl)-2-oxo-4-prop-2-enylazetidine-1-carbothioamide.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(2-chlorophenyl)-2-oxo-4-prop-2-enylazetidine-1-carbothioamide |
|---|---|
| PubChem CID | 122387183 |
| Molecular Formula | C21H31ClN2O2SSi |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(2-chlorophenyl)-2-oxo-4-prop-2-enylazetidine-1-carbothioamide |
| SMILES | C=CC[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H31ClN2O2SSi/c1-8-11-17-18(14(2)26-28(6,7)21(3,4)5)19(25)24(17)20(27)23-16-13-10-9-12-15(16)22/h8-10,12-14,17-18H,1,11H2,2-7H3,(H,23,27)/t14-,17-,18-/m1/s1 |
| InChIKey | MAFLASDJGJGELY-ZTFGCOKTSA-N |
| XLogP | 5.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|