C26H36ClNO6Si — CID 10720795
prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-2-chloroacetate (PubChem CID 10720795) has the molecular formula C26H36ClNO6Si and a molecular weight of 522.11 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-2-chloroacetate.
| Compound Name | prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-2-chloroacetate |
|---|---|
| PubChem CID | 10720795 |
| Molecular Formula | C26H36ClNO6Si |
| Molecular Weight | 522.11 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-2-chloroacetate |
| SMILES | C=CCOC(=O)C(Cl)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1CC(=O)[C@@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C26H36ClNO6Si/c1-8-13-32-25(31)23(27)28-18(15-19(29)21-14-17-11-9-10-12-20(17)33-21)22(24(28)30)16(2)34-35(6,7)26(3,4)5/h8-12,16,18,21-23H,1,13-15H2,2-7H3/t16-,18-,21+,22-,23?/m1/s1 |
| InChIKey | HXVXDMWDEWVUGU-FAQLIIJQSA-N |
| XLogP | 4.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.11 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|