C26H41ClN4O6Si — CID 10626854
prop-2-enyl 2-[(2R,3S)-2-[2-[1-(2-acetamidoethyl)-5-methylpyrazol-3-yl]-2-oxoethyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-2-chloroacetate (PubChem CID 10626854) has the molecular formula C26H41ClN4O6Si and a molecular weight of 569.18 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3S)-2-[2-[1-(2-acetamidoethyl)-5-methylpyrazol-3-yl]-2-oxoethyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-2-chloroacetate.
| Compound Name | prop-2-enyl 2-[(2R,3S)-2-[2-[1-(2-acetamidoethyl)-5-methylpyrazol-3-yl]-2-oxoethyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-2-chloroacetate |
|---|---|
| PubChem CID | 10626854 |
| Molecular Formula | C26H41ClN4O6Si |
| Molecular Weight | 569.18 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | prop-2-enyl 2-[(2R,3S)-2-[2-[1-(2-acetamidoethyl)-5-methylpyrazol-3-yl]-2-oxoethyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-2-chloroacetate |
| SMILES | C=CCOC(=O)C(Cl)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1CC(=O)c1cc(C)n(CCNC(C)=O)n1 |
| InChI | InChI=1S/C26H41ClN4O6Si/c1-10-13-36-25(35)23(27)31-20(22(24(31)34)17(3)37-38(8,9)26(5,6)7)15-21(33)19-14-16(2)30(29-19)12-11-28-18(4)32/h10,14,17,20,22-23H,1,11-13,15H2,2-9H3,(H,28,32)/t17-,20-,22-,23?/m1/s1 |
| InChIKey | IASLEZOVEIJZGZ-XZXVWMQDSA-N |
| XLogP | 3.43 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|