C26H38ClIN2O2SSi — CID 122397283
(5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(3-chlorophenyl)imino-4-(1-iodoethenyl)-4-pentyl-3-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 122397283) has the molecular formula C26H38ClIN2O2SSi and a molecular weight of 633.11 g/mol. Its IUPAC name is (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(3-chlorophenyl)imino-4-(1-iodoethenyl)-4-pentyl-3-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(3-chlorophenyl)imino-4-(1-iodoethenyl)-4-pentyl-3-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 122397283 |
| Molecular Formula | C26H38ClIN2O2SSi |
| Molecular Weight | 633.11 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(3-chlorophenyl)imino-4-(1-iodoethenyl)-4-pentyl-3-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | C=C(I)C1(CCCCC)S/C(=N\c2cccc(Cl)c2)N2C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C26H38ClIN2O2SSi/c1-9-10-11-15-26(18(3)28)22-21(17(2)32-34(7,8)25(4,5)6)23(31)30(22)24(33-26)29-20-14-12-13-19(27)16-20/h12-14,16-17,21-22H,3,9-11,15H2,1-2,4-8H3/b29-24-/t17-,21-,22+,26?/m1/s1 |
| InChIKey | ZOGIUFQPTDPULJ-VBSSJUFMSA-N |
| XLogP | 8.58 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.11 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|