C17H29ClN2O2Si — CID 141473363
5-[tert-butyl(dimethyl)silyl]oxy-N'-(3-chlorophenyl)-N-hydroxypentanimidamide (PubChem CID 141473363) has the molecular formula C17H29ClN2O2Si and a molecular weight of 356.97 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-N'-(3-chlorophenyl)-N-hydroxypentanimidamide.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-N'-(3-chlorophenyl)-N-hydroxypentanimidamide |
|---|---|
| PubChem CID | 141473363 |
| Molecular Formula | C17H29ClN2O2Si |
| Molecular Weight | 356.97 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-N'-(3-chlorophenyl)-N-hydroxypentanimidamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC/C(=N\c1cccc(Cl)c1)NO |
| InChI | InChI=1S/C17H29ClN2O2Si/c1-17(2,3)23(4,5)22-12-7-6-11-16(20-21)19-15-10-8-9-14(18)13-15/h8-10,13,21H,6-7,11-12H2,1-5H3,(H,19,20) |
| InChIKey | DIOBHVZIMAWHIE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.97 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|