C18H29ClN2OSSi — CID 118798885
4-[tert-butyl(dimethyl)silyl]oxy-N-(4-chlorophenyl)piperidine-1-carbothioamide (PubChem CID 118798885) has the molecular formula C18H29ClN2OSSi and a molecular weight of 385.05 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-N-(4-chlorophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-N-(4-chlorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 118798885 |
| Molecular Formula | C18H29ClN2OSSi |
| Molecular Weight | 385.05 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-N-(4-chlorophenyl)piperidine-1-carbothioamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(C(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H29ClN2OSSi/c1-18(2,3)24(4,5)22-16-10-12-21(13-11-16)17(23)20-15-8-6-14(19)7-9-15/h6-9,16H,10-13H2,1-5H3,(H,20,23) |
| InChIKey | GYWQFBJNRXFCGC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.05 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|