C14H19ClN2S — CID 40642609
(2S,6S)-N-(4-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide (PubChem CID 40642609) has the molecular formula C14H19ClN2S and a molecular weight of 282.84 g/mol. Its IUPAC name is (2S,6S)-N-(4-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide.
| Compound Name | (2S,6S)-N-(4-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 40642609 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2S,6S)-N-(4-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2S/c1-10-4-3-5-11(2)17(10)14(18)16-13-8-6-12(15)7-9-13/h6-11H,3-5H2,1-2H3,(H,16,18)/t10-,11-/m0/s1 |
| InChIKey | JPZBWHJKHSZIBM-QWRGUYRKSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|