C15H22ClN3O — CID 83021450
N-(4-chlorophenyl)-2-[(2,6-dimethylpiperidin-1-yl)amino]acetamide (PubChem CID 83021450) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2,6-dimethylpiperidin-1-yl)amino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2,6-dimethylpiperidin-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 83021450 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2,6-dimethylpiperidin-1-yl)amino]acetamide |
| SMILES | CC1CCCC(C)N1NCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClN3O/c1-11-4-3-5-12(2)19(11)17-10-15(20)18-14-8-6-13(16)7-9-14/h6-9,11-12,17H,3-5,10H2,1-2H3,(H,18,20) |
| InChIKey | PKAQPCHPLRLAPN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |