C20H30ClN3 — CID 44890377
N-(4-chlorophenyl)-N'-cyclohexyl-2,6-dimethylpiperidine-1-carboximidamide (PubChem CID 44890377) has the molecular formula C20H30ClN3 and a molecular weight of 347.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-cyclohexyl-2,6-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-(4-chlorophenyl)-N'-cyclohexyl-2,6-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 44890377 |
| Molecular Formula | C20H30ClN3 |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-(4-chlorophenyl)-N'-cyclohexyl-2,6-dimethylpiperidine-1-carboximidamide |
| SMILES | CC1CCCC(C)N1/C(=N\C1CCCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H30ClN3/c1-15-7-6-8-16(2)24(15)20(22-18-9-4-3-5-10-18)23-19-13-11-17(21)12-14-19/h11-16,18H,3-10H2,1-2H3,(H,22,23) |
| InChIKey | FEXUZVCHLBWNMN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|