C13H19N3O2S2 — CID 3261166
4-methyl-N-(4-sulfamoylphenyl)piperidine-1-carbothioamide (PubChem CID 3261166) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-methyl-N-(4-sulfamoylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-methyl-N-(4-sulfamoylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3261166 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-methyl-N-(4-sulfamoylphenyl)piperidine-1-carbothioamide |
| SMILES | CC1CCN(C(=S)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-10-6-8-16(9-7-10)13(19)15-11-2-4-12(5-3-11)20(14,17)18/h2-5,10H,6-9H2,1H3,(H,15,19)(H2,14,17,18) |
| InChIKey | CVMROBVHLKPXJW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|