C14H21N3O3S — CID 40794398
(3S,5S)-3,5-dimethyl-N-(4-sulfamoylphenyl)piperidine-1-carboxamide (PubChem CID 40794398) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-N-(4-sulfamoylphenyl)piperidine-1-carboxamide.
| Compound Name | (3S,5S)-3,5-dimethyl-N-(4-sulfamoylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 40794398 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-N-(4-sulfamoylphenyl)piperidine-1-carboxamide |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)Nc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-10-7-11(2)9-17(8-10)14(18)16-12-3-5-13(6-4-12)21(15,19)20/h3-6,10-11H,7-9H2,1-2H3,(H,16,18)(H2,15,19,20)/t10-,11-/m0/s1 |
| InChIKey | ZTTFBYKCKJATHA-QWRGUYRKSA-N |
| XLogP | 1.84 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |