C14H18FN3O5S — CID 122102384
1-[(3-fluoro-5-sulfamoylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122102384) has the molecular formula C14H18FN3O5S and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-[(3-fluoro-5-sulfamoylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(3-fluoro-5-sulfamoylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122102384 |
| Molecular Formula | C14H18FN3O5S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-[(3-fluoro-5-sulfamoylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)Nc2cc(F)cc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C14H18FN3O5S/c1-8-2-9(13(19)20)7-18(6-8)14(21)17-11-3-10(15)4-12(5-11)24(16,22)23/h3-5,8-9H,2,6-7H2,1H3,(H,17,21)(H,19,20)(H2,16,22,23) |
| InChIKey | QXLUNZBYYQGERZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |