C15H24N3O3S+ — CID 5084841
2-(3,5-dimethylpiperidin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 5084841) has the molecular formula C15H24N3O3S+ and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 5084841 |
| Molecular Formula | C15H24N3O3S+ |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC1CC(C)C[NH+](CC(=O)Nc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C15H23N3O3S/c1-11-7-12(2)9-18(8-11)10-15(19)17-13-3-5-14(6-4-13)22(16,20)21/h3-6,11-12H,7-10H2,1-2H3,(H,17,19)(H2,16,20,21)/p+1 |
| InChIKey | BNZHPFUXYCHQOY-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |