C16H17ClN4OS — CID 58974012
N-(4-chlorophenyl)-4-pyrimidin-2-yloxypiperidine-1-carbothioamide (PubChem CID 58974012) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-pyrimidin-2-yloxypiperidine-1-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-4-pyrimidin-2-yloxypiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 58974012 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-(4-chlorophenyl)-4-pyrimidin-2-yloxypiperidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCC(Oc2ncccn2)CC1 |
| InChI | InChI=1S/C16H17ClN4OS/c17-12-2-4-13(5-3-12)20-16(23)21-10-6-14(7-11-21)22-15-18-8-1-9-19-15/h1-5,8-9,14H,6-7,10-11H2,(H,20,23) |
| InChIKey | IHDSFOPXZSTZQA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|