C18H25NO2 — CID 118230381
benzyl N-(2-methylhex-5-en-2-yl)-N-prop-2-enylcarbamate (PubChem CID 118230381) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is benzyl N-(2-methylhex-5-en-2-yl)-N-prop-2-enylcarbamate.
| Compound Name | benzyl N-(2-methylhex-5-en-2-yl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 118230381 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | benzyl N-(2-methylhex-5-en-2-yl)-N-prop-2-enylcarbamate |
| SMILES | C=CCCC(C)(C)N(CC=C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c1-5-7-13-18(3,4)19(14-6-2)17(20)21-15-16-11-9-8-10-12-16/h5-6,8-12H,1-2,7,13-15H2,3-4H3 |
| InChIKey | PYTZXXZUXCNYMV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|