C19H22ClF2NO4 — CID 10960403
methyl 2-[chloro(difluoro)methyl]-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]hex-5-enoate (PubChem CID 10960403) has the molecular formula C19H22ClF2NO4 and a molecular weight of 401.84 g/mol. Its IUPAC name is methyl 2-[chloro(difluoro)methyl]-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]hex-5-enoate.
| Compound Name | methyl 2-[chloro(difluoro)methyl]-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]hex-5-enoate |
|---|---|
| PubChem CID | 10960403 |
| Molecular Formula | C19H22ClF2NO4 |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 2-[chloro(difluoro)methyl]-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]hex-5-enoate |
| SMILES | C=CCCC(C(=O)OC)(N(CC=C)C(=O)OCc1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C19H22ClF2NO4/c1-4-6-12-18(16(24)26-3,19(20,21)22)23(13-5-2)17(25)27-14-15-10-8-7-9-11-15/h4-5,7-11H,1-2,6,12-14H2,3H3 |
| InChIKey | BCBOOAOKWUICIJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|