C14H17F3N2O2 — CID 162772534
(2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide (PubChem CID 162772534) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is (2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide.
| Compound Name | (2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide |
|---|---|
| PubChem CID | 162772534 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide |
| SMILES | C=CCC[C@@](OCc1ccccc1)(C(=O)NN)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O2/c1-2-3-9-13(12(20)19-18,14(15,16)17)21-10-11-7-5-4-6-8-11/h2,4-8H,1,3,9-10,18H2,(H,19,20)/t13-/m1/s1 |
| InChIKey | IEAIMLTXINLKRQ-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|