C26H29F3N2O4 — CID 163434714
N-[2-(5-methyl-6-pent-4-enoxy-2-pyridinyl)-2-oxoethyl]-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enamide (PubChem CID 163434714) has the molecular formula C26H29F3N2O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is N-[2-(5-methyl-6-pent-4-enoxy-2-pyridinyl)-2-oxoethyl]-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enamide.
| Compound Name | N-[2-(5-methyl-6-pent-4-enoxy-2-pyridinyl)-2-oxoethyl]-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enamide |
|---|---|
| PubChem CID | 163434714 |
| Molecular Formula | C26H29F3N2O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[2-(5-methyl-6-pent-4-enoxy-2-pyridinyl)-2-oxoethyl]-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enamide |
| SMILES | C=CCCCOc1nc(C(=O)CNC(=O)C(CC=C)(OCc2ccccc2)C(F)(F)F)ccc1C |
| InChI | InChI=1S/C26H29F3N2O4/c1-4-6-10-16-34-23-19(3)13-14-21(31-23)22(32)17-30-24(33)25(15-5-2,26(27,28)29)35-18-20-11-8-7-9-12-20/h4-5,7-9,11-14H,1-2,6,10,15-18H2,3H3,(H,30,33) |
| InChIKey | OXCJNLADCNPFSO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|