About 2-benzyl-1,1,1-trifluoropent-4-en-2-ol
2-benzyl-1,1,1-trifluoropent-4-en-2-ol (PubChem CID 14764222) has the molecular formula C12H13F3O
and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-benzyl-1,1,1-trifluoropent-4-en-2-ol.
Molecular Properties
| Compound Name | 2-benzyl-1,1,1-trifluoropent-4-en-2-ol |
| PubChem CID | 14764222 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-benzyl-1,1,1-trifluoropent-4-en-2-ol |
| SMILES | C=CCC(O)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O/c1-2-8-11(16,12(13,14)15)9-10-6-4-3-5-7-10/h2-7,16H,1,8-9H2 |
| InChIKey | WKHHHBDDSXQYDZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,1,1-trifluoropent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,1,1-trifluoropent-4-en-2-ol?
The IUPAC name of 2-benzyl-1,1,1-trifluoropent-4-en-2-ol (CID 14764222) is 2-benzyl-1,1,1-trifluoropent-4-en-2-ol.
What is the SMILES notation for 2-benzyl-1,1,1-trifluoropent-4-en-2-ol?
The canonical SMILES for 2-benzyl-1,1,1-trifluoropent-4-en-2-ol is C=CCC(O)(Cc1ccccc1)C(F)(F)F.
What is the InChIKey of 2-benzyl-1,1,1-trifluoropent-4-en-2-ol?
The InChIKey is WKHHHBDDSXQYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O/c1-2-8-11(16,12(13,14)15)9-10-6-4-3-5-7-10/h2-7,16H,1,8-9H2.
What are the key properties of 2-benzyl-1,1,1-trifluoropent-4-en-2-ol?
2-benzyl-1,1,1-trifluoropent-4-en-2-ol has a molecular weight of 230.23 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,1,1-trifluoropent-4-en-2-ol is sourced from PubChem (CID 14764222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).