C16H15BrF2O — CID 107140484
2-benzyl-1-bromo-1,1-difluoro-3-phenylpropan-2-ol (PubChem CID 107140484) has the molecular formula C16H15BrF2O and a molecular weight of 341.19 g/mol. Its IUPAC name is 2-benzyl-1-bromo-1,1-difluoro-3-phenylpropan-2-ol.
| Compound Name | 2-benzyl-1-bromo-1,1-difluoro-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 107140484 |
| Molecular Formula | C16H15BrF2O |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-benzyl-1-bromo-1,1-difluoro-3-phenylpropan-2-ol |
| SMILES | OC(Cc1ccccc1)(Cc1ccccc1)C(F)(F)Br |
| InChI | InChI=1S/C16H15BrF2O/c17-16(18,19)15(20,11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,20H,11-12H2 |
| InChIKey | HVMZNSIVGPEZSG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|