C28H35ClF6N4O4 — CID 163534976
bis((2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide);hydrochloride (PubChem CID 163534976) has the molecular formula C28H35ClF6N4O4 and a molecular weight of 641.05 g/mol. Its IUPAC name is bis((2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide);hydrochloride.
| Compound Name | bis((2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide);hydrochloride |
|---|---|
| PubChem CID | 163534976 |
| Molecular Formula | C28H35ClF6N4O4 |
| Molecular Weight | 641.05 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | bis((2R)-2-phenylmethoxy-2-(trifluoromethyl)hex-5-enehydrazide);hydrochloride |
| SMILES | C=CCC[C@@](OCc1ccccc1)(C(=O)NN)C(F)(F)F.C=CCC[C@@](OCc1ccccc1)(C(=O)NN)C(F)(F)F.Cl |
| InChI | InChI=1S/2C14H17F3N2O2.ClH/c2*1-2-3-9-13(12(20)19-18,14(15,16)17)21-10-11-7-5-4-6-8-11;/h2*2,4-8H,1,3,9-10,18H2,(H,19,20);1H/t2*13-;/m11./s1 |
| InChIKey | ZZDBGTCJWYGDBC-WFEKIRLUSA-N |
| XLogP | 5.34 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.05 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|