C19H25F3N2O4 — CID 162772804
tert-butyl N-[[2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoyl]amino]carbamate (PubChem CID 162772804) has the molecular formula C19H25F3N2O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is tert-butyl N-[[2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoyl]amino]carbamate |
|---|---|
| PubChem CID | 162772804 |
| Molecular Formula | C19H25F3N2O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | tert-butyl N-[[2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoyl]amino]carbamate |
| SMILES | C=CCCC(OCc1ccccc1)(C(=O)NNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H25F3N2O4/c1-5-6-12-18(19(20,21)22,27-13-14-10-8-7-9-11-14)15(25)23-24-16(26)28-17(2,3)4/h5,7-11H,1,6,12-13H2,2-4H3,(H,23,25)(H,24,26) |
| InChIKey | QIDMQQJVVYDEMV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|