C32H40F6N4O7 — CID 169126160
tert-butyl N-[2-[[[(2R,8S)-8-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoyl]amino]carbamoyl]-6-prop-2-enoxy-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 169126160) has the molecular formula C32H40F6N4O7 and a molecular weight of 706.68 g/mol. Its IUPAC name is tert-butyl N-[2-[[[(2R,8S)-8-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoyl]amino]carbamoyl]-6-prop-2-enoxy-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[(2R,8S)-8-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoyl]amino]carbamoyl]-6-prop-2-enoxy-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169126160 |
| Molecular Formula | C32H40F6N4O7 |
| Molecular Weight | 706.68 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | tert-butyl N-[2-[[[(2R,8S)-8-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)nonanoyl]amino]carbamoyl]-6-prop-2-enoxy-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C=CCOc1nc(C(=O)NNC(=O)[C@@](CCCCC[C@H](C)O)(OCc2ccccc2)C(F)(F)F)c(NC(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C32H40F6N4O7/c1-6-17-47-26-22(31(33,34)35)18-23(39-28(46)49-29(3,4)5)24(40-26)25(44)41-42-27(45)30(32(36,37)38,16-12-8-9-13-20(2)43)48-19-21-14-10-7-11-15-21/h6-7,10-11,14-15,18,20,43H,1,8-9,12-13,16-17,19H2,2-5H3,(H,39,46)(H,41,44)(H,42,45)/t20-,30+/m0/s1 |
| InChIKey | LRLDECSWDBHUAW-WENCNXQZSA-N |
| XLogP | 6.62 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|