C29H35F3N4O6 — CID 169126054
tert-butyl N-[6-but-3-enoxy-2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 169126054) has the molecular formula C29H35F3N4O6 and a molecular weight of 592.62 g/mol. Its IUPAC name is tert-butyl N-[6-but-3-enoxy-2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-but-3-enoxy-2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169126054 |
| Molecular Formula | C29H35F3N4O6 |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | tert-butyl N-[6-but-3-enoxy-2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C=CCCOc1nc(C(=O)NNC(=O)C(CCC=C)OCc2ccccc2)c(NC(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C29H35F3N4O6/c1-6-8-15-22(41-18-19-13-11-10-12-14-19)24(37)35-36-25(38)23-21(33-27(39)42-28(3,4)5)17-20(29(30,31)32)26(34-23)40-16-9-7-2/h6-7,10-14,17,22H,1-2,8-9,15-16,18H2,3-5H3,(H,33,39)(H,35,37)(H,36,38) |
| InChIKey | OBGKOSNRYVFOAO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|