C20H20F3NO3 — CID 167442855
tert-butyl 3-[6-phenylmethoxy-5-(trifluoromethyl)-3-pyridinyl]prop-2-enoate (PubChem CID 167442855) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is tert-butyl 3-[6-phenylmethoxy-5-(trifluoromethyl)-3-pyridinyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[6-phenylmethoxy-5-(trifluoromethyl)-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 167442855 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl 3-[6-phenylmethoxy-5-(trifluoromethyl)-3-pyridinyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1cnc(OCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3NO3/c1-19(2,3)27-17(25)10-9-15-11-16(20(21,22)23)18(24-12-15)26-13-14-7-5-4-6-8-14/h4-12H,13H2,1-3H3 |
| InChIKey | JTFYAPPSAVRISA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|