C22H23FN2O6S — CID 90771056
tert-butyl 3-[3-fluoro-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-5-phenylmethoxyphenyl]prop-2-enoate (PubChem CID 90771056) has the molecular formula C22H23FN2O6S and a molecular weight of 462.50 g/mol. Its IUPAC name is tert-butyl 3-[3-fluoro-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-5-phenylmethoxyphenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[3-fluoro-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-5-phenylmethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90771056 |
| Molecular Formula | C22H23FN2O6S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | tert-butyl 3-[3-fluoro-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-5-phenylmethoxyphenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1cc(F)c(N2C=C(O)NS2(=O)=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H23FN2O6S/c1-22(2,3)31-20(27)10-9-16-11-17(23)21(25-13-19(26)24-32(25,28)29)18(12-16)30-14-15-7-5-4-6-8-15/h4-13,24,26H,14H2,1-3H3 |
| InChIKey | CLFSYJASTHXGRM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|