C22H17FN2O5S — CID 91079553
[5-benzyl-3-fluoro-2-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl] benzoate (PubChem CID 91079553) has the molecular formula C22H17FN2O5S and a molecular weight of 440.45 g/mol. Its IUPAC name is [5-benzyl-3-fluoro-2-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl] benzoate.
| Compound Name | [5-benzyl-3-fluoro-2-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 91079553 |
| Molecular Formula | C22H17FN2O5S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [5-benzyl-3-fluoro-2-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl] benzoate |
| SMILES | O=C(Oc1cc(Cc2ccccc2)cc(F)c1N1C=C(O)NS1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C22H17FN2O5S/c23-18-12-16(11-15-7-3-1-4-8-15)13-19(30-22(27)17-9-5-2-6-10-17)21(18)25-14-20(26)24-31(25,28)29/h1-10,12-14,24,26H,11H2 |
| InChIKey | HWHDPXZDICWCPE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|