C21H22N2O5S — CID 91487907
[3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-6,6-dimethyl-7,8-dihydro-5H-naphthalen-2-yl] benzoate (PubChem CID 91487907) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is [3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-6,6-dimethyl-7,8-dihydro-5H-naphthalen-2-yl] benzoate.
| Compound Name | [3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-6,6-dimethyl-7,8-dihydro-5H-naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 91487907 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-6,6-dimethyl-7,8-dihydro-5H-naphthalen-2-yl] benzoate |
| SMILES | CC1(C)CCc2cc(OC(=O)c3ccccc3)c(N3C=C(O)NS3(=O)=O)cc2C1 |
| InChI | InChI=1S/C21H22N2O5S/c1-21(2)9-8-15-11-18(28-20(25)14-6-4-3-5-7-14)17(10-16(15)12-21)23-13-19(24)22-29(23,26)27/h3-7,10-11,13,22,24H,8-9,12H2,1-2H3 |
| InChIKey | XEUJHNAVYRVKOX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|