C21H20N2O6S — CID 91259492
6-[3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-4-phenylmethoxyphenyl]hex-5-ynoic acid (PubChem CID 91259492) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is 6-[3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-4-phenylmethoxyphenyl]hex-5-ynoic acid.
| Compound Name | 6-[3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-4-phenylmethoxyphenyl]hex-5-ynoic acid |
|---|---|
| PubChem CID | 91259492 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 6-[3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-4-phenylmethoxyphenyl]hex-5-ynoic acid |
| SMILES | O=C(O)CCCC#Cc1ccc(OCc2ccccc2)c(N2C=C(O)NS2(=O)=O)c1 |
| InChI | InChI=1S/C21H20N2O6S/c24-20-14-23(30(27,28)22-20)18-13-16(7-3-2-6-10-21(25)26)11-12-19(18)29-15-17-8-4-1-5-9-17/h1,4-5,8-9,11-14,22,24H,2,6,10,15H2,(H,25,26) |
| InChIKey | FMUJLNCKPXPEGU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|