C18H16O2 — CID 15588906
6-(4-phenylphenyl)hex-5-ynoic acid (PubChem CID 15588906) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(4-phenylphenyl)hex-5-ynoic acid.
| Compound Name | 6-(4-phenylphenyl)hex-5-ynoic acid |
|---|---|
| PubChem CID | 15588906 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-(4-phenylphenyl)hex-5-ynoic acid |
| SMILES | O=C(O)CCCC#Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16O2/c19-18(20)10-6-1-3-7-15-11-13-17(14-12-15)16-8-4-2-5-9-16/h2,4-5,8-9,11-14H,1,6,10H2,(H,19,20) |
| InChIKey | AYPNWWQZKSAOFC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|