C19H19NO — CID 102443613
N-[5-(4-methylphenyl)pent-4-ynyl]benzamide (PubChem CID 102443613) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[5-(4-methylphenyl)pent-4-ynyl]benzamide.
| Compound Name | N-[5-(4-methylphenyl)pent-4-ynyl]benzamide |
|---|---|
| PubChem CID | 102443613 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[5-(4-methylphenyl)pent-4-ynyl]benzamide |
| SMILES | Cc1ccc(C#CCCCNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO/c1-16-11-13-17(14-12-16)8-4-3-7-15-20-19(21)18-9-5-2-6-10-18/h2,5-6,9-14H,3,7,15H2,1H3,(H,20,21) |
| InChIKey | ARWRVIXBAPNXOU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|