C24H21N3O5S — CID 90961949
3-[2-[4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-3-phenylmethoxyphenyl]ethenyl]benzamide (PubChem CID 90961949) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-[2-[4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-3-phenylmethoxyphenyl]ethenyl]benzamide.
| Compound Name | 3-[2-[4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-3-phenylmethoxyphenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 90961949 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-[2-[4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)-3-phenylmethoxyphenyl]ethenyl]benzamide |
| SMILES | NC(=O)c1cccc(C=Cc2ccc(N3C=C(O)NS3(=O)=O)c(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H21N3O5S/c25-24(29)20-8-4-7-17(13-20)9-10-18-11-12-21(27-15-23(28)26-33(27,30)31)22(14-18)32-16-19-5-2-1-3-6-19/h1-15,26,28H,16H2,(H2,25,29) |
| InChIKey | OLHMPPRPJHWTPX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|