C22H26O3 — CID 90417960
tert-butyl (E)-3-(2,3-dimethyl-4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 90417960) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl (E)-3-(2,3-dimethyl-4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | tert-butyl (E)-3-(2,3-dimethyl-4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90417960 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | tert-butyl (E)-3-(2,3-dimethyl-4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | Cc1c(/C=C/C(=O)OC(C)(C)C)ccc(OCc2ccccc2)c1C |
| InChI | InChI=1S/C22H26O3/c1-16-17(2)20(24-15-18-9-7-6-8-10-18)13-11-19(16)12-14-21(23)25-22(3,4)5/h6-14H,15H2,1-5H3/b14-12+ |
| InChIKey | AWYTZUQPJMSRII-WYMLVPIESA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|