C29H31BrF6N4O7 — CID 172558848
tert-butyl N-[6-bromo-2-[[[(2R)-6-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)hexanoyl]amino]carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 172558848) has the molecular formula C29H31BrF6N4O7 and a molecular weight of 741.48 g/mol. Its IUPAC name is tert-butyl N-[6-bromo-2-[[[(2R)-6-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)hexanoyl]amino]carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-bromo-2-[[[(2R)-6-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)hexanoyl]amino]carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 172558848 |
| Molecular Formula | C29H31BrF6N4O7 |
| Molecular Weight | 741.48 g/mol |
| Exact Mass | 740.13 |
| IUPAC Name | tert-butyl N-[6-bromo-2-[[[(2R)-6-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)hexanoyl]amino]carbamoyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c(Br)nc1C(=O)NNC(=O)[C@@](CCCCC1OC=CO1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H31BrF6N4O7/c1-26(2,3)47-25(43)37-19-15-18(28(31,32)33)22(30)38-21(19)23(41)39-40-24(42)27(29(34,35)36,46-16-17-9-5-4-6-10-17)12-8-7-11-20-44-13-14-45-20/h4-6,9-10,13-15,20H,7-8,11-12,16H2,1-3H3,(H,37,43)(H,39,41)(H,40,42)/t27-/m1/s1 |
| InChIKey | IBXNZKQFTUIPNN-HHHXNRCGSA-N |
| XLogP | 6.89 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.48 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|