C33H36F6N4O5 — CID 169136946
tert-butyl N-[6-(2,2-dimethylpent-4-enoyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate (PubChem CID 169136946) has the molecular formula C33H36F6N4O5 and a molecular weight of 682.66 g/mol. Its IUPAC name is tert-butyl N-[6-(2,2-dimethylpent-4-enoyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(2,2-dimethylpent-4-enoyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169136946 |
| Molecular Formula | C33H36F6N4O5 |
| Molecular Weight | 682.66 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | tert-butyl N-[6-(2,2-dimethylpent-4-enoyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate |
| SMILES | C=CCC[C@@](OCc1ccccc1)(c1nnc(-c2nc(C(=O)C(C)(C)CC=C)c(C(F)(F)F)cc2NC(=O)OC(C)(C)C)o1)C(F)(F)F |
| InChI | InChI=1S/C33H36F6N4O5/c1-8-10-17-31(33(37,38)39,46-19-20-14-12-11-13-15-20)27-43-42-26(47-27)24-22(40-28(45)48-29(3,4)5)18-21(32(34,35)36)23(41-24)25(44)30(6,7)16-9-2/h8-9,11-15,18H,1-2,10,16-17,19H2,3-7H3,(H,40,45)/t31-/m1/s1 |
| InChIKey | MVXOLVKKHPMGNK-WJOKGBTCSA-N |
| XLogP | 9.22 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.66 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|