C32H42F6N6O6 — CID 169137366
tert-butyl N-[6-[(pent-4-enoylamino)carbamoyl]-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-(2-methylidenebutoxy)hex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate;ethane (PubChem CID 169137366) has the molecular formula C32H42F6N6O6 and a molecular weight of 720.71 g/mol. Its IUPAC name is tert-butyl N-[6-[(pent-4-enoylamino)carbamoyl]-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-(2-methylidenebutoxy)hex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[6-[(pent-4-enoylamino)carbamoyl]-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-(2-methylidenebutoxy)hex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 169137366 |
| Molecular Formula | C32H42F6N6O6 |
| Molecular Weight | 720.71 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | tert-butyl N-[6-[(pent-4-enoylamino)carbamoyl]-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-(2-methylidenebutoxy)hex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate;ethane |
| SMILES | C=CCCC(=O)NNC(=O)c1nc(-c2nnc(C(CCC=C)(OCC(=C)CC)C(F)(F)F)o2)c(NC(=O)OC(C)(C)C)cc1C(F)(F)F.CC |
| InChI | InChI=1S/C30H36F6N6O6.C2H6/c1-8-11-13-20(43)39-40-23(44)21-18(29(31,32)33)15-19(37-26(45)48-27(5,6)7)22(38-21)24-41-42-25(47-24)28(14-12-9-2,30(34,35)36)46-16-17(4)10-3;1-2/h8-9,15H,1-2,4,10-14,16H2,3,5-7H3,(H,37,45)(H,39,43)(H,40,44);1-2H3 |
| InChIKey | IBLURSJCLLFURQ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 157.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|