C27H27F7N4O5 — CID 169136778
tert-butyl N-[6-(1-hydroxypent-4-enyl)-2-[5-[2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 169136778) has the molecular formula C27H27F7N4O5 and a molecular weight of 620.52 g/mol. Its IUPAC name is tert-butyl N-[6-(1-hydroxypent-4-enyl)-2-[5-[2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(1-hydroxypent-4-enyl)-2-[5-[2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169136778 |
| Molecular Formula | C27H27F7N4O5 |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | tert-butyl N-[6-(1-hydroxypent-4-enyl)-2-[5-[2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C=CCCC(O)c1nc(-c2nnc(C(O)(c3cc(C)ccc3F)C(F)(F)F)o2)c(NC(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C27H27F7N4O5/c1-6-7-8-18(39)19-15(26(29,30)31)12-17(35-23(40)43-24(3,4)5)20(36-19)21-37-38-22(42-21)25(41,27(32,33)34)14-11-13(2)9-10-16(14)28/h6,9-12,18,39,41H,1,7-8H2,2-5H3,(H,35,40) |
| InChIKey | ZNGYEGIPMRAQGC-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|