C28H33F3N4O5 — CID 169126089
tert-butyl N-[(8E)-6-phenylmethoxy-14-(trifluoromethyl)-12,18-dioxa-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate;ethane (PubChem CID 169126089) has the molecular formula C28H33F3N4O5 and a molecular weight of 562.59 g/mol. Its IUPAC name is tert-butyl N-[(8E)-6-phenylmethoxy-14-(trifluoromethyl)-12,18-dioxa-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[(8E)-6-phenylmethoxy-14-(trifluoromethyl)-12,18-dioxa-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate;ethane |
|---|---|
| PubChem CID | 169126089 |
| Molecular Formula | C28H33F3N4O5 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | tert-butyl N-[(8E)-6-phenylmethoxy-14-(trifluoromethyl)-12,18-dioxa-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)C/C=C/CCO2 |
| InChI | InChI=1S/C26H27F3N4O5.C2H6/c1-25(2,3)38-24(34)30-18-14-17(26(27,28)29)21-31-20(18)23-33-32-22(37-23)19(12-8-5-9-13-35-21)36-15-16-10-6-4-7-11-16;1-2/h4-8,10-11,14,19H,9,12-13,15H2,1-3H3,(H,30,34);1-2H3/b8-5+; |
| InChIKey | SVOJRCZPBDBCTE-HAAWTFQLSA-N |
| XLogP | 7.51 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|