C31H31F6N5O6 — CID 163377304
tert-butyl N-[(9Z,12R)-16-oxo-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaen-21-yl]carbamate (PubChem CID 163377304) has the molecular formula C31H31F6N5O6 and a molecular weight of 683.61 g/mol. Its IUPAC name is tert-butyl N-[(9Z,12R)-16-oxo-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaen-21-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z,12R)-16-oxo-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaen-21-yl]carbamate |
|---|---|
| PubChem CID | 163377304 |
| Molecular Formula | C31H31F6N5O6 |
| Molecular Weight | 683.61 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | tert-butyl N-[(9Z,12R)-16-oxo-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaen-21-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CC/C=C\C[C@@H]1COCC(=O)N21 |
| InChI | InChI=1S/C31H31F6N5O6/c1-28(2,3)48-27(44)38-21-14-20(30(32,33)34)24-39-23(21)25-40-41-26(47-25)29(31(35,36)37,46-15-18-10-6-4-7-11-18)13-9-5-8-12-19-16-45-17-22(43)42(19)24/h4-8,10-11,14,19H,9,12-13,15-17H2,1-3H3,(H,38,44)/b8-5-/t19-,29?/m1/s1 |
| InChIKey | AKSLLHCBUHWXJW-FTPRYCOVSA-N |
| XLogP | 6.94 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|