C33H30F6N4O4 — CID 169137149
tert-butyl N-[(9Z)-6-phenylmethoxy-6,19-bis(trifluoromethyl)-23-oxa-3,4,22-triazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,12,14,16,18(22),19-nonaen-21-yl]carbamate (PubChem CID 169137149) has the molecular formula C33H30F6N4O4 and a molecular weight of 660.62 g/mol. Its IUPAC name is tert-butyl N-[(9Z)-6-phenylmethoxy-6,19-bis(trifluoromethyl)-23-oxa-3,4,22-triazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,12,14,16,18(22),19-nonaen-21-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z)-6-phenylmethoxy-6,19-bis(trifluoromethyl)-23-oxa-3,4,22-triazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,12,14,16,18(22),19-nonaen-21-yl]carbamate |
|---|---|
| PubChem CID | 169137149 |
| Molecular Formula | C33H30F6N4O4 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | tert-butyl N-[(9Z)-6-phenylmethoxy-6,19-bis(trifluoromethyl)-23-oxa-3,4,22-triazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,12,14,16,18(22),19-nonaen-21-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CC/C=C\Cc1ccccc1-2 |
| InChI | InChI=1S/C33H30F6N4O4/c1-30(2,3)47-29(44)40-24-18-23(32(34,35)36)25-22-16-10-9-15-21(22)14-8-5-11-17-31(33(37,38)39,45-19-20-12-6-4-7-13-20)28-43-42-27(46-28)26(24)41-25/h4-10,12-13,15-16,18H,11,14,17,19H2,1-3H3,(H,40,44)/b8-5- |
| InChIKey | RFYFITNDECHGGC-YVMONPNESA-N |
| XLogP | 9.03 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|